C21H11F5N2O2 — CID 86802704
2,5-difluoro-9-oxo-N-[4-(trifluoromethyl)phenyl]-10H-acridine-4-carboxamide (PubChem CID 86802704) has the molecular formula C21H11F5N2O2 and a molecular weight of 418.32 g/mol. Its IUPAC name is 2,5-difluoro-9-oxo-N-[4-(trifluoromethyl)phenyl]-10H-acridine-4-carboxamide.
| Compound Name | 2,5-difluoro-9-oxo-N-[4-(trifluoromethyl)phenyl]-10H-acridine-4-carboxamide |
|---|---|
| PubChem CID | 86802704 |
| Molecular Formula | C21H11F5N2O2 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 2,5-difluoro-9-oxo-N-[4-(trifluoromethyl)phenyl]-10H-acridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)c1cc(F)cc2c(=O)c3cccc(F)c3[nH]c12 |
| InChI | InChI=1S/C21H11F5N2O2/c22-11-8-14-17(28-18-13(19(14)29)2-1-3-16(18)23)15(9-11)20(30)27-12-6-4-10(5-7-12)21(24,25)26/h1-9H,(H,27,30)(H,28,29) |
| InChIKey | GAOFCVIWLQJKQV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|