C23H20FN3O2 — CID 167965304
N-[3-[(dimethylamino)methyl]phenyl]-5-fluoro-9-oxo-10H-acridine-4-carboxamide (PubChem CID 167965304) has the molecular formula C23H20FN3O2 and a molecular weight of 389.43 g/mol. Its IUPAC name is N-[3-[(dimethylamino)methyl]phenyl]-5-fluoro-9-oxo-10H-acridine-4-carboxamide.
| Compound Name | N-[3-[(dimethylamino)methyl]phenyl]-5-fluoro-9-oxo-10H-acridine-4-carboxamide |
|---|---|
| PubChem CID | 167965304 |
| Molecular Formula | C23H20FN3O2 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N-[3-[(dimethylamino)methyl]phenyl]-5-fluoro-9-oxo-10H-acridine-4-carboxamide |
| SMILES | CN(C)Cc1cccc(NC(=O)c2cccc3c(=O)c4cccc(F)c4[nH]c23)c1 |
| InChI | InChI=1S/C23H20FN3O2/c1-27(2)13-14-6-3-7-15(12-14)25-23(29)18-10-4-8-16-20(18)26-21-17(22(16)28)9-5-11-19(21)24/h3-12H,13H2,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | PTJHEMOGHHNHDR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|