C33H32FN3O5 — CID 44523246
N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propoxy]phenyl]-5-fluoro-9-oxo-10H-acridine-4-carboxamide (PubChem CID 44523246) has the molecular formula C33H32FN3O5 and a molecular weight of 569.63 g/mol. Its IUPAC name is N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propoxy]phenyl]-5-fluoro-9-oxo-10H-acridine-4-carboxamide.
| Compound Name | N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propoxy]phenyl]-5-fluoro-9-oxo-10H-acridine-4-carboxamide |
|---|---|
| PubChem CID | 44523246 |
| Molecular Formula | C33H32FN3O5 |
| Molecular Weight | 569.63 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propoxy]phenyl]-5-fluoro-9-oxo-10H-acridine-4-carboxamide |
| SMILES | COc1ccc(CN(C)CCCOc2ccc(NC(=O)c3cccc4c(=O)c5cccc(F)c5[nH]c34)cc2)cc1OC |
| InChI | InChI=1S/C33H32FN3O5/c1-37(20-21-11-16-28(40-2)29(19-21)41-3)17-6-18-42-23-14-12-22(13-15-23)35-33(39)26-9-4-7-24-30(26)36-31-25(32(24)38)8-5-10-27(31)34/h4-5,7-16,19H,6,17-18,20H2,1-3H3,(H,35,39)(H,36,38) |
| InChIKey | PDRZEJQPKYJNPH-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.63 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|