C36H39N3O6 — CID 139770120
N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propoxy]-2-methoxyphenyl]-2-(5-methyl-9-oxo-10H-acridin-4-yl)acetamide (PubChem CID 139770120) has the molecular formula C36H39N3O6 and a molecular weight of 609.72 g/mol. Its IUPAC name is N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propoxy]-2-methoxyphenyl]-2-(5-methyl-9-oxo-10H-acridin-4-yl)acetamide.
| Compound Name | N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propoxy]-2-methoxyphenyl]-2-(5-methyl-9-oxo-10H-acridin-4-yl)acetamide |
|---|---|
| PubChem CID | 139770120 |
| Molecular Formula | C36H39N3O6 |
| Molecular Weight | 609.72 g/mol |
| Exact Mass | 609.28 |
| IUPAC Name | N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propoxy]-2-methoxyphenyl]-2-(5-methyl-9-oxo-10H-acridin-4-yl)acetamide |
| SMILES | COc1cc(OCCCN(C)Cc2ccc(OC)c(OC)c2)ccc1NC(=O)Cc1cccc2c(=O)c3cccc(C)c3[nH]c12 |
| InChI | InChI=1S/C36H39N3O6/c1-23-9-6-11-27-34(23)38-35-25(10-7-12-28(35)36(27)41)20-33(40)37-29-15-14-26(21-31(29)43-4)45-18-8-17-39(2)22-24-13-16-30(42-3)32(19-24)44-5/h6-7,9-16,19,21H,8,17-18,20,22H2,1-5H3,(H,37,40)(H,38,41) |
| InChIKey | ZVKLOVRVPKOOJB-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.72 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|