C34H34N4O6 — CID 139770115
N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propyl]phenyl]-2-(5-nitro-9-oxo-10H-acridin-4-yl)acetamide (PubChem CID 139770115) has the molecular formula C34H34N4O6 and a molecular weight of 594.67 g/mol. Its IUPAC name is N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propyl]phenyl]-2-(5-nitro-9-oxo-10H-acridin-4-yl)acetamide.
| Compound Name | N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propyl]phenyl]-2-(5-nitro-9-oxo-10H-acridin-4-yl)acetamide |
|---|---|
| PubChem CID | 139770115 |
| Molecular Formula | C34H34N4O6 |
| Molecular Weight | 594.67 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | N-[4-[3-[(3,4-dimethoxyphenyl)methyl-methylamino]propyl]phenyl]-2-(5-nitro-9-oxo-10H-acridin-4-yl)acetamide |
| SMILES | COc1ccc(CN(C)CCCc2ccc(NC(=O)Cc3cccc4c(=O)c5cccc([N+](=O)[O-])c5[nH]c34)cc2)cc1OC |
| InChI | InChI=1S/C34H34N4O6/c1-37(21-23-14-17-29(43-2)30(19-23)44-3)18-6-7-22-12-15-25(16-13-22)35-31(39)20-24-8-4-9-26-32(24)36-33-27(34(26)40)10-5-11-28(33)38(41)42/h4-5,8-17,19H,6-7,18,20-21H2,1-3H3,(H,35,39)(H,36,40) |
| InChIKey | YCSFPRXJMBOWLK-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.67 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|