C34H33N3O4 — CID 139770111
N-[4-[2-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-2-(5-methoxy-9-oxo-10H-acridin-4-yl)acetamide (PubChem CID 139770111) has the molecular formula C34H33N3O4 and a molecular weight of 547.66 g/mol. Its IUPAC name is N-[4-[2-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-2-(5-methoxy-9-oxo-10H-acridin-4-yl)acetamide.
| Compound Name | N-[4-[2-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-2-(5-methoxy-9-oxo-10H-acridin-4-yl)acetamide |
|---|---|
| PubChem CID | 139770111 |
| Molecular Formula | C34H33N3O4 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | N-[4-[2-(7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-2-(5-methoxy-9-oxo-10H-acridin-4-yl)acetamide |
| SMILES | COc1ccc2c(c1)CN(CCc1ccc(NC(=O)Cc3cccc4c(=O)c5cccc(OC)c5[nH]c34)cc1)CC2 |
| InChI | InChI=1S/C34H33N3O4/c1-40-27-14-11-23-16-18-37(21-25(23)19-27)17-15-22-9-12-26(13-10-22)35-31(38)20-24-5-3-6-28-32(24)36-33-29(34(28)39)7-4-8-30(33)41-2/h3-14,19H,15-18,20-21H2,1-2H3,(H,35,38)(H,36,39) |
| InChIKey | YHIMNMWXFRCFKL-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|