C35H34N2O5 — CID 167614674
4-[2-[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]acetyl]-5-methoxy-10H-acridin-9-one (PubChem CID 167614674) has the molecular formula C35H34N2O5 and a molecular weight of 562.67 g/mol. Its IUPAC name is 4-[2-[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]acetyl]-5-methoxy-10H-acridin-9-one.
| Compound Name | 4-[2-[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]acetyl]-5-methoxy-10H-acridin-9-one |
|---|---|
| PubChem CID | 167614674 |
| Molecular Formula | C35H34N2O5 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | 4-[2-[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]acetyl]-5-methoxy-10H-acridin-9-one |
| SMILES | COc1cc2c(cc1OC)CN(CCc1ccc(CC(=O)c3cccc4c(=O)c5cccc(OC)c5[nH]c34)cc1)CC2 |
| InChI | InChI=1S/C35H34N2O5/c1-40-30-9-5-8-28-34(30)36-33-26(6-4-7-27(33)35(28)39)29(38)18-23-12-10-22(11-13-23)14-16-37-17-15-24-19-31(41-2)32(42-3)20-25(24)21-37/h4-13,19-20H,14-18,21H2,1-3H3,(H,36,39) |
| InChIKey | LOMLMDQQCGFLRC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|