C36H37N3O8 — CID 162331024
N-[4-[4-[(3,4-dimethoxyphenyl)methyl-methylamino]butyl]phenyl]-9-oxo-10H-acridine-4-carboxamide;oxalic acid (PubChem CID 162331024) has the molecular formula C36H37N3O8 and a molecular weight of 639.71 g/mol. Its IUPAC name is N-[4-[4-[(3,4-dimethoxyphenyl)methyl-methylamino]butyl]phenyl]-9-oxo-10H-acridine-4-carboxamide;oxalic acid.
| Compound Name | N-[4-[4-[(3,4-dimethoxyphenyl)methyl-methylamino]butyl]phenyl]-9-oxo-10H-acridine-4-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 162331024 |
| Molecular Formula | C36H37N3O8 |
| Molecular Weight | 639.71 g/mol |
| Exact Mass | 639.26 |
| IUPAC Name | N-[4-[4-[(3,4-dimethoxyphenyl)methyl-methylamino]butyl]phenyl]-9-oxo-10H-acridine-4-carboxamide;oxalic acid |
| SMILES | COc1ccc(CN(C)CCCCc2ccc(NC(=O)c3cccc4c(=O)c5ccccc5[nH]c34)cc2)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C34H35N3O4.C2H2O4/c1-37(22-24-16-19-30(40-2)31(21-24)41-3)20-7-6-9-23-14-17-25(18-15-23)35-34(39)28-12-8-11-27-32(28)36-29-13-5-4-10-26(29)33(27)38;3-1(4)2(5)6/h4-5,8,10-19,21H,6-7,9,20,22H2,1-3H3,(H,35,39)(H,36,38);(H,3,4)(H,5,6) |
| InChIKey | GEARMJCMBAVUMZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 158.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.71 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|