C34H33N3O4 — CID 67692252
N-[4-[4-[2-(3,4-dimethoxyphenyl)ethylamino]but-2-enyl]phenyl]-9-oxo-10H-acridine-4-carboxamide (PubChem CID 67692252) has the molecular formula C34H33N3O4 and a molecular weight of 547.66 g/mol. Its IUPAC name is N-[4-[4-[2-(3,4-dimethoxyphenyl)ethylamino]but-2-enyl]phenyl]-9-oxo-10H-acridine-4-carboxamide.
| Compound Name | N-[4-[4-[2-(3,4-dimethoxyphenyl)ethylamino]but-2-enyl]phenyl]-9-oxo-10H-acridine-4-carboxamide |
|---|---|
| PubChem CID | 67692252 |
| Molecular Formula | C34H33N3O4 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | N-[4-[4-[2-(3,4-dimethoxyphenyl)ethylamino]but-2-enyl]phenyl]-9-oxo-10H-acridine-4-carboxamide |
| SMILES | COc1ccc(CCNCC=CCc2ccc(NC(=O)c3cccc4c(=O)c5ccccc5[nH]c34)cc2)cc1OC |
| InChI | InChI=1S/C34H33N3O4/c1-40-30-18-15-24(22-31(30)41-2)19-21-35-20-6-5-8-23-13-16-25(17-14-23)36-34(39)28-11-7-10-27-32(28)37-29-12-4-3-9-26(29)33(27)38/h3-7,9-18,22,35H,8,19-21H2,1-2H3,(H,36,39)(H,37,38) |
| InChIKey | KVTOVLSEDPXFRG-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|