C22H19NO3 — CID 71571229
4-[2-(3-hydroxy-4-methoxyphenyl)ethyl]-10H-acridin-9-one (PubChem CID 71571229) has the molecular formula C22H19NO3 and a molecular weight of 345.40 g/mol. Its IUPAC name is 4-[2-(3-hydroxy-4-methoxyphenyl)ethyl]-10H-acridin-9-one.
| Compound Name | 4-[2-(3-hydroxy-4-methoxyphenyl)ethyl]-10H-acridin-9-one |
|---|---|
| PubChem CID | 71571229 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 4-[2-(3-hydroxy-4-methoxyphenyl)ethyl]-10H-acridin-9-one |
| SMILES | COc1ccc(CCc2cccc3c(=O)c4ccccc4[nH]c23)cc1O |
| InChI | InChI=1S/C22H19NO3/c1-26-20-12-10-14(13-19(20)24)9-11-15-5-4-7-17-21(15)23-18-8-3-2-6-16(18)22(17)25/h2-8,10,12-13,24H,9,11H2,1H3,(H,23,25) |
| InChIKey | DFSYSXZNFNWXSD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|