C34H35N3O5 — CID 67692141
N-[4-[3-[2-(3,4-dimethoxyphenyl)ethylamino]propoxy]-2-methylphenyl]-9-oxo-10H-acridine-4-carboxamide (PubChem CID 67692141) has the molecular formula C34H35N3O5 and a molecular weight of 565.67 g/mol. Its IUPAC name is N-[4-[3-[2-(3,4-dimethoxyphenyl)ethylamino]propoxy]-2-methylphenyl]-9-oxo-10H-acridine-4-carboxamide.
| Compound Name | N-[4-[3-[2-(3,4-dimethoxyphenyl)ethylamino]propoxy]-2-methylphenyl]-9-oxo-10H-acridine-4-carboxamide |
|---|---|
| PubChem CID | 67692141 |
| Molecular Formula | C34H35N3O5 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | N-[4-[3-[2-(3,4-dimethoxyphenyl)ethylamino]propoxy]-2-methylphenyl]-9-oxo-10H-acridine-4-carboxamide |
| SMILES | COc1ccc(CCNCCCOc2ccc(NC(=O)c3cccc4c(=O)c5ccccc5[nH]c34)c(C)c2)cc1OC |
| InChI | InChI=1S/C34H35N3O5/c1-22-20-24(42-19-7-17-35-18-16-23-12-15-30(40-2)31(21-23)41-3)13-14-28(22)37-34(39)27-10-6-9-26-32(27)36-29-11-5-4-8-25(29)33(26)38/h4-6,8-15,20-21,35H,7,16-19H2,1-3H3,(H,36,38)(H,37,39) |
| InChIKey | SSLVIKWIPJSZNW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 101.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|