C14H11NO4 — CID 46856149
1,8-dihydroxy-4-methoxy-10H-acridin-9-one (PubChem CID 46856149) has the molecular formula C14H11NO4 and a molecular weight of 257.25 g/mol. Its IUPAC name is 1,8-dihydroxy-4-methoxy-10H-acridin-9-one.
| Compound Name | 1,8-dihydroxy-4-methoxy-10H-acridin-9-one |
|---|---|
| PubChem CID | 46856149 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 1,8-dihydroxy-4-methoxy-10H-acridin-9-one |
| SMILES | COc1ccc(O)c2c(=O)c3c(O)cccc3[nH]c12 |
| InChI | InChI=1S/C14H11NO4/c1-19-10-6-5-9(17)12-13(10)15-7-3-2-4-8(16)11(7)14(12)18/h2-6,16-17H,1H3,(H,15,18) |
| InChIKey | WHBKGKPVUDFTMH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|