C17H17NO5 — CID 5494828
1-hydroxy-3,5,6-trimethoxy-10-methylacridin-9-one (PubChem CID 5494828) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is 1-hydroxy-3,5,6-trimethoxy-10-methylacridin-9-one.
| Compound Name | 1-hydroxy-3,5,6-trimethoxy-10-methylacridin-9-one |
|---|---|
| PubChem CID | 5494828 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 1-hydroxy-3,5,6-trimethoxy-10-methylacridin-9-one |
| SMILES | COc1cc(O)c2c(=O)c3ccc(OC)c(OC)c3n(C)c2c1 |
| InChI | InChI=1S/C17H17NO5/c1-18-11-7-9(21-2)8-12(19)14(11)16(20)10-5-6-13(22-3)17(23-4)15(10)18/h5-8,19H,1-4H3 |
| InChIKey | CHCYJKZBXNSGCG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|