C17H17NO6 — CID 19093029
1,5-dihydroxy-2,3,4-trimethoxy-10-methylacridin-9-one (PubChem CID 19093029) has the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. Its IUPAC name is 1,5-dihydroxy-2,3,4-trimethoxy-10-methylacridin-9-one.
| Compound Name | 1,5-dihydroxy-2,3,4-trimethoxy-10-methylacridin-9-one |
|---|---|
| PubChem CID | 19093029 |
| Molecular Formula | C17H17NO6 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 1,5-dihydroxy-2,3,4-trimethoxy-10-methylacridin-9-one |
| SMILES | COc1c(OC)c(OC)c2c(c1O)c(=O)c1cccc(O)c1n2C |
| InChI | InChI=1S/C17H17NO6/c1-18-11-8(6-5-7-9(11)19)13(20)10-12(18)15(22-2)17(24-4)16(23-3)14(10)21/h5-7,19,21H,1-4H3 |
| InChIKey | QYPQTPVQPNLXHV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|