C18H19NO7 — CID 5480208
1,6-dihydroxy-2,3,4,5-tetramethoxy-10-methylacridin-9-one (PubChem CID 5480208) has the molecular formula C18H19NO7 and a molecular weight of 361.35 g/mol. Its IUPAC name is 1,6-dihydroxy-2,3,4,5-tetramethoxy-10-methylacridin-9-one.
| Compound Name | 1,6-dihydroxy-2,3,4,5-tetramethoxy-10-methylacridin-9-one |
|---|---|
| PubChem CID | 5480208 |
| Molecular Formula | C18H19NO7 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 1,6-dihydroxy-2,3,4,5-tetramethoxy-10-methylacridin-9-one |
| SMILES | COc1c(OC)c(OC)c2c(c1O)c(=O)c1ccc(O)c(OC)c1n2C |
| InChI | InChI=1S/C18H19NO7/c1-19-11-8(6-7-9(20)15(11)23-2)13(21)10-12(19)16(24-3)18(26-5)17(25-4)14(10)22/h6-7,20,22H,1-5H3 |
| InChIKey | IHSANOPPEBGTGL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|