C33H33N3O2S — CID 54411710
N-[4-[4-[methyl-[(4-methylsulfanylphenyl)methyl]amino]butyl]phenyl]-9-oxo-10H-acridine-4-carboxamide (PubChem CID 54411710) has the molecular formula C33H33N3O2S and a molecular weight of 535.71 g/mol. Its IUPAC name is N-[4-[4-[methyl-[(4-methylsulfanylphenyl)methyl]amino]butyl]phenyl]-9-oxo-10H-acridine-4-carboxamide.
| Compound Name | N-[4-[4-[methyl-[(4-methylsulfanylphenyl)methyl]amino]butyl]phenyl]-9-oxo-10H-acridine-4-carboxamide |
|---|---|
| PubChem CID | 54411710 |
| Molecular Formula | C33H33N3O2S |
| Molecular Weight | 535.71 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | N-[4-[4-[methyl-[(4-methylsulfanylphenyl)methyl]amino]butyl]phenyl]-9-oxo-10H-acridine-4-carboxamide |
| SMILES | CSc1ccc(CN(C)CCCCc2ccc(NC(=O)c3cccc4c(=O)c5ccccc5[nH]c34)cc2)cc1 |
| InChI | InChI=1S/C33H33N3O2S/c1-36(22-24-15-19-26(39-2)20-16-24)21-6-5-8-23-13-17-25(18-14-23)34-33(38)29-11-7-10-28-31(29)35-30-12-4-3-9-27(30)32(28)37/h3-4,7,9-20H,5-6,8,21-22H2,1-2H3,(H,34,38)(H,35,37) |
| InChIKey | VUPAHHBPBHWWDR-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.71 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|