C34H35N3O5S — CID 139770148
N-[4-[2-[(3,4-dimethoxyphenyl)methyl-methylamino]ethoxy]phenyl]-2-(2-methylsulfanyl-9-oxo-10H-acridin-4-yl)acetamide (PubChem CID 139770148) has the molecular formula C34H35N3O5S and a molecular weight of 597.74 g/mol. Its IUPAC name is N-[4-[2-[(3,4-dimethoxyphenyl)methyl-methylamino]ethoxy]phenyl]-2-(2-methylsulfanyl-9-oxo-10H-acridin-4-yl)acetamide.
| Compound Name | N-[4-[2-[(3,4-dimethoxyphenyl)methyl-methylamino]ethoxy]phenyl]-2-(2-methylsulfanyl-9-oxo-10H-acridin-4-yl)acetamide |
|---|---|
| PubChem CID | 139770148 |
| Molecular Formula | C34H35N3O5S |
| Molecular Weight | 597.74 g/mol |
| Exact Mass | 597.23 |
| IUPAC Name | N-[4-[2-[(3,4-dimethoxyphenyl)methyl-methylamino]ethoxy]phenyl]-2-(2-methylsulfanyl-9-oxo-10H-acridin-4-yl)acetamide |
| SMILES | COc1ccc(CN(C)CCOc2ccc(NC(=O)Cc3cc(SC)cc4c(=O)c5ccccc5[nH]c34)cc2)cc1OC |
| InChI | InChI=1S/C34H35N3O5S/c1-37(21-22-9-14-30(40-2)31(17-22)41-3)15-16-42-25-12-10-24(11-13-25)35-32(38)19-23-18-26(43-4)20-28-33(23)36-29-8-6-5-7-27(29)34(28)39/h5-14,17-18,20H,15-16,19,21H2,1-4H3,(H,35,38)(H,36,39) |
| InChIKey | KVADKTVLGHHDHP-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.74 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|