C36H38FN3O4 — CID 139770051
N-[4-[5-[(3,4-dimethoxyphenyl)methyl-methylamino]pentyl]phenyl]-2-(5-fluoro-9-oxo-10H-acridin-4-yl)acetamide (PubChem CID 139770051) has the molecular formula C36H38FN3O4 and a molecular weight of 595.72 g/mol. Its IUPAC name is N-[4-[5-[(3,4-dimethoxyphenyl)methyl-methylamino]pentyl]phenyl]-2-(5-fluoro-9-oxo-10H-acridin-4-yl)acetamide.
| Compound Name | N-[4-[5-[(3,4-dimethoxyphenyl)methyl-methylamino]pentyl]phenyl]-2-(5-fluoro-9-oxo-10H-acridin-4-yl)acetamide |
|---|---|
| PubChem CID | 139770051 |
| Molecular Formula | C36H38FN3O4 |
| Molecular Weight | 595.72 g/mol |
| Exact Mass | 595.28 |
| IUPAC Name | N-[4-[5-[(3,4-dimethoxyphenyl)methyl-methylamino]pentyl]phenyl]-2-(5-fluoro-9-oxo-10H-acridin-4-yl)acetamide |
| SMILES | COc1ccc(CN(C)CCCCCc2ccc(NC(=O)Cc3cccc4c(=O)c5cccc(F)c5[nH]c34)cc2)cc1OC |
| InChI | InChI=1S/C36H38FN3O4/c1-40(23-25-16-19-31(43-2)32(21-25)44-3)20-6-4-5-9-24-14-17-27(18-15-24)38-33(41)22-26-10-7-11-28-34(26)39-35-29(36(28)42)12-8-13-30(35)37/h7-8,10-19,21H,4-6,9,20,22-23H2,1-3H3,(H,38,41)(H,39,42) |
| InChIKey | LILSTGRUMPKVFB-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.72 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|