C32H30N2O5S — CID 57089519
N-[4-[3-(3,4-dimethoxy-N-methylanilino)propoxy]phenyl]-9-oxothioxanthene-4-carboxamide (PubChem CID 57089519) has the molecular formula C32H30N2O5S and a molecular weight of 554.67 g/mol. Its IUPAC name is N-[4-[3-(3,4-dimethoxy-N-methylanilino)propoxy]phenyl]-9-oxothioxanthene-4-carboxamide.
| Compound Name | N-[4-[3-(3,4-dimethoxy-N-methylanilino)propoxy]phenyl]-9-oxothioxanthene-4-carboxamide |
|---|---|
| PubChem CID | 57089519 |
| Molecular Formula | C32H30N2O5S |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | N-[4-[3-(3,4-dimethoxy-N-methylanilino)propoxy]phenyl]-9-oxothioxanthene-4-carboxamide |
| SMILES | COc1ccc(N(C)CCCOc2ccc(NC(=O)c3cccc4c(=O)c5ccccc5sc34)cc2)cc1OC |
| InChI | InChI=1S/C32H30N2O5S/c1-34(22-14-17-27(37-2)28(20-22)38-3)18-7-19-39-23-15-12-21(13-16-23)33-32(36)26-10-6-9-25-30(35)24-8-4-5-11-29(24)40-31(25)26/h4-6,8-17,20H,7,18-19H2,1-3H3,(H,33,36) |
| InChIKey | ZWBYGAPGUHGUGH-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|