C34H34N2O4S — CID 22917135
N-[4-[3-[1-(3,4-dimethoxyphenyl)propan-2-ylamino]propyl]phenyl]-9-oxothioxanthene-4-carboxamide (PubChem CID 22917135) has the molecular formula C34H34N2O4S and a molecular weight of 566.72 g/mol. Its IUPAC name is N-[4-[3-[1-(3,4-dimethoxyphenyl)propan-2-ylamino]propyl]phenyl]-9-oxothioxanthene-4-carboxamide.
| Compound Name | N-[4-[3-[1-(3,4-dimethoxyphenyl)propan-2-ylamino]propyl]phenyl]-9-oxothioxanthene-4-carboxamide |
|---|---|
| PubChem CID | 22917135 |
| Molecular Formula | C34H34N2O4S |
| Molecular Weight | 566.72 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | N-[4-[3-[1-(3,4-dimethoxyphenyl)propan-2-ylamino]propyl]phenyl]-9-oxothioxanthene-4-carboxamide |
| SMILES | COc1ccc(CC(C)NCCCc2ccc(NC(=O)c3cccc4c(=O)c5ccccc5sc34)cc2)cc1OC |
| InChI | InChI=1S/C34H34N2O4S/c1-22(20-24-15-18-29(39-2)30(21-24)40-3)35-19-7-8-23-13-16-25(17-14-23)36-34(38)28-11-6-10-27-32(37)26-9-4-5-12-31(26)41-33(27)28/h4-6,9-18,21-22,35H,7-8,19-20H2,1-3H3,(H,36,38) |
| InChIKey | XTMKDZOCDNUVHK-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.72 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|