C31H28N2O5S — CID 56977715
N-[4-[2-(3,4-dimethoxy-N-methylanilino)ethoxy]phenyl]-9-oxothioxanthene-4-carboxamide (PubChem CID 56977715) has the molecular formula C31H28N2O5S and a molecular weight of 540.64 g/mol. Its IUPAC name is N-[4-[2-(3,4-dimethoxy-N-methylanilino)ethoxy]phenyl]-9-oxothioxanthene-4-carboxamide.
| Compound Name | N-[4-[2-(3,4-dimethoxy-N-methylanilino)ethoxy]phenyl]-9-oxothioxanthene-4-carboxamide |
|---|---|
| PubChem CID | 56977715 |
| Molecular Formula | C31H28N2O5S |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | N-[4-[2-(3,4-dimethoxy-N-methylanilino)ethoxy]phenyl]-9-oxothioxanthene-4-carboxamide |
| SMILES | COc1ccc(N(C)CCOc2ccc(NC(=O)c3cccc4c(=O)c5ccccc5sc34)cc2)cc1OC |
| InChI | InChI=1S/C31H28N2O5S/c1-33(21-13-16-26(36-2)27(19-21)37-3)17-18-38-22-14-11-20(12-15-22)32-31(35)25-9-6-8-24-29(34)23-7-4-5-10-28(23)39-30(24)25/h4-16,19H,17-18H2,1-3H3,(H,32,35) |
| InChIKey | KEILEFCMVVAZQB-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|