C16H14IN3O2 — CID 70658321
N-(2-aminoethyl)-5-iodo-9-oxo-10H-acridine-4-carboxamide (PubChem CID 70658321) has the molecular formula C16H14IN3O2 and a molecular weight of 407.21 g/mol. Its IUPAC name is N-(2-aminoethyl)-5-iodo-9-oxo-10H-acridine-4-carboxamide.
| Compound Name | N-(2-aminoethyl)-5-iodo-9-oxo-10H-acridine-4-carboxamide |
|---|---|
| PubChem CID | 70658321 |
| Molecular Formula | C16H14IN3O2 |
| Molecular Weight | 407.21 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | N-(2-aminoethyl)-5-iodo-9-oxo-10H-acridine-4-carboxamide |
| SMILES | NCCNC(=O)c1cccc2c(=O)c3cccc(I)c3[nH]c12 |
| InChI | InChI=1S/C16H14IN3O2/c17-12-6-2-4-10-14(12)20-13-9(15(10)21)3-1-5-11(13)16(22)19-8-7-18/h1-6H,7-8,18H2,(H,19,22)(H,20,21) |
| InChIKey | MHQNAQNEMLWPLS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.21 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|