C20H23ClIN3O2 — CID 44587791
N-[2-(diethylamino)ethyl]-7-(125I)iodo-9-oxo-10H-acridine-4-carboxamide;hydrochloride (PubChem CID 44587791) has the molecular formula C20H23ClIN3O2 and a molecular weight of 497.78 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-7-(125I)iodo-9-oxo-10H-acridine-4-carboxamide;hydrochloride.
| Compound Name | N-[2-(diethylamino)ethyl]-7-(125I)iodo-9-oxo-10H-acridine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 44587791 |
| Molecular Formula | C20H23ClIN3O2 |
| Molecular Weight | 497.78 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-7-(125I)iodo-9-oxo-10H-acridine-4-carboxamide;hydrochloride |
| SMILES | CCN(CC)CCNC(=O)c1cccc2c(=O)c3cc([125I])ccc3[nH]c12.Cl |
| InChI | InChI=1S/C20H22IN3O2.ClH/c1-3-24(4-2)11-10-22-20(26)15-7-5-6-14-18(15)23-17-9-8-13(21)12-16(17)19(14)25;/h5-9,12H,3-4,10-11H2,1-2H3,(H,22,26)(H,23,25);1H/i21-2; |
| InChIKey | UCFZNYDVCSPDJW-FRVBVOKESA-N |
| XLogP | 3.78 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.78 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|