C19H23ClN2OS — CID 138398454
N-[2-(diethylamino)ethyl]dibenzothiophene-4-carboxamide;hydrochloride (PubChem CID 138398454) has the molecular formula C19H23ClN2OS and a molecular weight of 362.93 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]dibenzothiophene-4-carboxamide;hydrochloride.
| Compound Name | N-[2-(diethylamino)ethyl]dibenzothiophene-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 138398454 |
| Molecular Formula | C19H23ClN2OS |
| Molecular Weight | 362.93 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-[2-(diethylamino)ethyl]dibenzothiophene-4-carboxamide;hydrochloride |
| SMILES | CCN(CC)CCNC(=O)c1cccc2c1sc1ccccc12.Cl |
| InChI | InChI=1S/C19H22N2OS.ClH/c1-3-21(4-2)13-12-20-19(22)16-10-7-9-15-14-8-5-6-11-17(14)23-18(15)16;/h5-11H,3-4,12-13H2,1-2H3,(H,20,22);1H |
| InChIKey | YJRACWSORHKRMZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.93 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |