C20H24ClN2OS- — CID 5351142
1-[2-(diethylamino)ethylamino]-4-methylthioxanthen-9-one chloride (PubChem CID 5351142) has the molecular formula C20H24ClN2OS- and a molecular weight of 375.95 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethylamino]-4-methylthioxanthen-9-one chloride.
| Compound Name | 1-[2-(diethylamino)ethylamino]-4-methylthioxanthen-9-one chloride |
|---|---|
| PubChem CID | 5351142 |
| Molecular Formula | C20H24ClN2OS- |
| Molecular Weight | 375.95 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 1-[2-(diethylamino)ethylamino]-4-methylthioxanthen-9-one chloride |
| SMILES | CCN(CC)CCNc1ccc(C)c2sc3ccccc3c(=O)c12.[Cl-] |
| InChI | InChI=1S/C20H24N2OS.ClH/c1-4-22(5-2)13-12-21-16-11-10-14(3)20-18(16)19(23)15-8-6-7-9-17(15)24-20;/h6-11,21H,4-5,12-13H2,1-3H3;1H/p-1 |
| InChIKey | LAOOXBLMIJHMFO-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.95 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|