C21H27N3O3S2 — CID 10342947
N-[[1-[2-(diethylamino)ethylamino]-9-oxothioxanthen-4-yl](113C)methyl]methane(15N)sulfonamide (PubChem CID 10342947) has the molecular formula C21H27N3O3S2 and a molecular weight of 435.58 g/mol. Its IUPAC name is N-[[1-[2-(diethylamino)ethylamino]-9-oxothioxanthen-4-yl](113C)methyl]methane(15N)sulfonamide.
| Compound Name | N-[[1-[2-(diethylamino)ethylamino]-9-oxothioxanthen-4-yl](113C)methyl]methane(15N)sulfonamide |
|---|---|
| PubChem CID | 10342947 |
| Molecular Formula | C21H27N3O3S2 |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | N-[[1-[2-(diethylamino)ethylamino]-9-oxothioxanthen-4-yl](113C)methyl]methane(15N)sulfonamide |
| SMILES | CCN(CC)CCNc1ccc([13CH2][15NH]S(C)(=O)=O)c2sc3ccccc3c(=O)c12 |
| InChI | InChI=1S/C21H27N3O3S2/c1-4-24(5-2)13-12-22-17-11-10-15(14-23-29(3,26)27)21-19(17)20(25)16-8-6-7-9-18(16)28-21/h6-11,22-23H,4-5,12-14H2,1-3H3/i14+1,23+1 |
| InChIKey | NAMOLZVVTPNNTE-RYWMCZEOSA-N |
| XLogP | 3.22 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|