C21H27ClN2O2S — CID 11954300
1-[2-[ethyl(2-hydroxypropan-2-yl)amino]ethylamino]-4-methylthioxanthen-9-one;hydrochloride (PubChem CID 11954300) has the molecular formula C21H27ClN2O2S and a molecular weight of 406.98 g/mol. Its IUPAC name is 1-[2-[ethyl(2-hydroxypropan-2-yl)amino]ethylamino]-4-methylthioxanthen-9-one;hydrochloride.
| Compound Name | 1-[2-[ethyl(2-hydroxypropan-2-yl)amino]ethylamino]-4-methylthioxanthen-9-one;hydrochloride |
|---|---|
| PubChem CID | 11954300 |
| Molecular Formula | C21H27ClN2O2S |
| Molecular Weight | 406.98 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 1-[2-[ethyl(2-hydroxypropan-2-yl)amino]ethylamino]-4-methylthioxanthen-9-one;hydrochloride |
| SMILES | CCN(CCNc1ccc(C)c2sc3ccccc3c(=O)c12)C(C)(C)O.Cl |
| InChI | InChI=1S/C21H26N2O2S.ClH/c1-5-23(21(3,4)25)13-12-22-16-11-10-14(2)20-18(16)19(24)15-8-6-7-9-17(15)26-20;/h6-11,22,25H,5,12-13H2,1-4H3;1H |
| InChIKey | UIHFHPFXOHWWMY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.98 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|