C20H24ClN3O4S — CID 21144228
1-[1-[ethyl(2-hydroxyethyl)amino]propan-2-ylamino]-4-nitrothioxanthen-9-one;hydrochloride (PubChem CID 21144228) has the molecular formula C20H24ClN3O4S and a molecular weight of 437.95 g/mol. Its IUPAC name is 1-[1-[ethyl(2-hydroxyethyl)amino]propan-2-ylamino]-4-nitrothioxanthen-9-one;hydrochloride.
| Compound Name | 1-[1-[ethyl(2-hydroxyethyl)amino]propan-2-ylamino]-4-nitrothioxanthen-9-one;hydrochloride |
|---|---|
| PubChem CID | 21144228 |
| Molecular Formula | C20H24ClN3O4S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 1-[1-[ethyl(2-hydroxyethyl)amino]propan-2-ylamino]-4-nitrothioxanthen-9-one;hydrochloride |
| SMILES | CCN(CCO)CC(C)Nc1ccc([N+](=O)[O-])c2sc3ccccc3c(=O)c12.Cl |
| InChI | InChI=1S/C20H23N3O4S.ClH/c1-3-22(10-11-24)12-13(2)21-15-8-9-16(23(26)27)20-18(15)19(25)14-6-4-5-7-17(14)28-20;/h4-9,13,21,24H,3,10-12H2,1-2H3;1H |
| InChIKey | SEYOKBGFWOGXBT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|