C27H31N3O4S2 — CID 22915332
N-[[1-[2-(diethylamino)ethylamino]-9-oxothioxanthen-4-yl]methyl]-2-methoxybenzenesulfonamide (PubChem CID 22915332) has the molecular formula C27H31N3O4S2 and a molecular weight of 525.70 g/mol. Its IUPAC name is N-[[1-[2-(diethylamino)ethylamino]-9-oxothioxanthen-4-yl]methyl]-2-methoxybenzenesulfonamide.
| Compound Name | N-[[1-[2-(diethylamino)ethylamino]-9-oxothioxanthen-4-yl]methyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 22915332 |
| Molecular Formula | C27H31N3O4S2 |
| Molecular Weight | 525.70 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | N-[[1-[2-(diethylamino)ethylamino]-9-oxothioxanthen-4-yl]methyl]-2-methoxybenzenesulfonamide |
| SMILES | CCN(CC)CCNc1ccc(CNS(=O)(=O)c2ccccc2OC)c2sc3ccccc3c(=O)c12 |
| InChI | InChI=1S/C27H31N3O4S2/c1-4-30(5-2)17-16-28-21-15-14-19(18-29-36(32,33)24-13-9-7-11-22(24)34-3)27-25(21)26(31)20-10-6-8-12-23(20)35-27/h6-15,28-29H,4-5,16-18H2,1-3H3 |
| InChIKey | UDKCOPIHNKTQOK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.70 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|