C19H24N4OS — CID 59114351
6-(aminomethyl)-9-[2-(diethylamino)ethylamino]thiochromeno[3,2-b]pyridin-10-one (PubChem CID 59114351) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is 6-(aminomethyl)-9-[2-(diethylamino)ethylamino]thiochromeno[3,2-b]pyridin-10-one.
| Compound Name | 6-(aminomethyl)-9-[2-(diethylamino)ethylamino]thiochromeno[3,2-b]pyridin-10-one |
|---|---|
| PubChem CID | 59114351 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 6-(aminomethyl)-9-[2-(diethylamino)ethylamino]thiochromeno[3,2-b]pyridin-10-one |
| SMILES | CCN(CC)CCNc1ccc(CN)c2sc3cccnc3c(=O)c12 |
| InChI | InChI=1S/C19H24N4OS/c1-3-23(4-2)11-10-21-14-8-7-13(12-20)19-16(14)18(24)17-15(25-19)6-5-9-22-17/h5-9,21H,3-4,10-12,20H2,1-2H3 |
| InChIKey | CJQLODREIBYKDP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|