C20H26N4O3S2 — CID 59114371
N-[[6-[2-(diethylamino)ethylamino]-5-oxothiochromeno[2,3-c]pyridin-9-yl]methyl]methanesulfonamide (PubChem CID 59114371) has the molecular formula C20H26N4O3S2 and a molecular weight of 434.59 g/mol. Its IUPAC name is N-[[6-[2-(diethylamino)ethylamino]-5-oxothiochromeno[2,3-c]pyridin-9-yl]methyl]methanesulfonamide.
| Compound Name | N-[[6-[2-(diethylamino)ethylamino]-5-oxothiochromeno[2,3-c]pyridin-9-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 59114371 |
| Molecular Formula | C20H26N4O3S2 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | N-[[6-[2-(diethylamino)ethylamino]-5-oxothiochromeno[2,3-c]pyridin-9-yl]methyl]methanesulfonamide |
| SMILES | CCN(CC)CCNc1ccc(CNS(C)(=O)=O)c2sc3cnccc3c(=O)c12 |
| InChI | InChI=1S/C20H26N4O3S2/c1-4-24(5-2)11-10-22-16-7-6-14(12-23-29(3,26)27)20-18(16)19(25)15-8-9-21-13-17(15)28-20/h6-9,13,22-23H,4-5,10-12H2,1-3H3 |
| InChIKey | PDPALFPWHIAASO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|