C28H33N3O6S3 — CID 56988541
[benzenesulfonyl-[2-[1-[2-(diethylamino)ethylamino]-9-oxothioxanthen-4-yl]ethyl]amino] methanesulfonate (PubChem CID 56988541) has the molecular formula C28H33N3O6S3 and a molecular weight of 603.79 g/mol. Its IUPAC name is [benzenesulfonyl-[2-[1-[2-(diethylamino)ethylamino]-9-oxothioxanthen-4-yl]ethyl]amino] methanesulfonate.
| Compound Name | [benzenesulfonyl-[2-[1-[2-(diethylamino)ethylamino]-9-oxothioxanthen-4-yl]ethyl]amino] methanesulfonate |
|---|---|
| PubChem CID | 56988541 |
| Molecular Formula | C28H33N3O6S3 |
| Molecular Weight | 603.79 g/mol |
| Exact Mass | 603.15 |
| IUPAC Name | [benzenesulfonyl-[2-[1-[2-(diethylamino)ethylamino]-9-oxothioxanthen-4-yl]ethyl]amino] methanesulfonate |
| SMILES | CCN(CC)CCNc1ccc(CCN(OS(C)(=O)=O)S(=O)(=O)c2ccccc2)c2sc3ccccc3c(=O)c12 |
| InChI | InChI=1S/C28H33N3O6S3/c1-4-30(5-2)20-18-29-24-16-15-21(28-26(24)27(32)23-13-9-10-14-25(23)38-28)17-19-31(37-39(3,33)34)40(35,36)22-11-7-6-8-12-22/h6-16,29H,4-5,17-20H2,1-3H3 |
| InChIKey | MTOMDGJHUVPALS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.79 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|