C34H38N4OS — CID 152968434
1-[2-[2-[[7-ethyl-6-[(1S)-2-methylcyclopropyl]quinolin-4-yl]amino]ethyl-methylamino]ethylamino]-4-methylthioxanthen-9-one (PubChem CID 152968434) has the molecular formula C34H38N4OS and a molecular weight of 550.77 g/mol. Its IUPAC name is 1-[2-[2-[[7-ethyl-6-[(1S)-2-methylcyclopropyl]quinolin-4-yl]amino]ethyl-methylamino]ethylamino]-4-methylthioxanthen-9-one.
| Compound Name | 1-[2-[2-[[7-ethyl-6-[(1S)-2-methylcyclopropyl]quinolin-4-yl]amino]ethyl-methylamino]ethylamino]-4-methylthioxanthen-9-one |
|---|---|
| PubChem CID | 152968434 |
| Molecular Formula | C34H38N4OS |
| Molecular Weight | 550.77 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | 1-[2-[2-[[7-ethyl-6-[(1S)-2-methylcyclopropyl]quinolin-4-yl]amino]ethyl-methylamino]ethylamino]-4-methylthioxanthen-9-one |
| SMILES | CCc1cc2nccc(NCCN(C)CCNc3ccc(C)c4sc5ccccc5c(=O)c34)c2cc1[C@H]1CC1C |
| InChI | InChI=1S/C34H38N4OS/c1-5-23-19-30-27(20-26(23)25-18-22(25)3)28(12-13-35-30)36-14-16-38(4)17-15-37-29-11-10-21(2)34-32(29)33(39)24-8-6-7-9-31(24)40-34/h6-13,19-20,22,25,37H,5,14-18H2,1-4H3,(H,35,36)/t22?,25-/m0/s1 |
| InChIKey | URZFMDITTMEILC-TUXUZCGSSA-N |
| XLogP | 7.41 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.77 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|