C19H21IN4O — CID 59228758
N-[2-(diethylamino)ethyl]-7-(125I)iodophenazine-1-carboxamide (PubChem CID 59228758) has the molecular formula C19H21IN4O and a molecular weight of 446.31 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-7-(125I)iodophenazine-1-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-7-(125I)iodophenazine-1-carboxamide |
|---|---|
| PubChem CID | 59228758 |
| Molecular Formula | C19H21IN4O |
| Molecular Weight | 446.31 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-7-(125I)iodophenazine-1-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1cccc2nc3cc([125I])ccc3nc12 |
| InChI | InChI=1S/C19H21IN4O/c1-3-24(4-2)11-10-21-19(25)14-6-5-7-16-18(14)23-15-9-8-13(20)12-17(15)22-16/h5-9,12H,3-4,10-11H2,1-2H3,(H,21,25)/i20-2 |
| InChIKey | LMWVGVNYEPEHIN-STTHPYEQSA-N |
| XLogP | 3.46 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|