C16H22Cl2IN3O — CID 24879197
N-[2-(diethylamino)ethyl]-6-(125I)iodoquinoline-2-carboxamide;dihydrochloride (PubChem CID 24879197) has the molecular formula C16H22Cl2IN3O and a molecular weight of 468.18 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-6-(125I)iodoquinoline-2-carboxamide;dihydrochloride.
| Compound Name | N-[2-(diethylamino)ethyl]-6-(125I)iodoquinoline-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 24879197 |
| Molecular Formula | C16H22Cl2IN3O |
| Molecular Weight | 468.18 g/mol |
| Exact Mass | 467.02 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-6-(125I)iodoquinoline-2-carboxamide;dihydrochloride |
| SMILES | CCN(CC)CCNC(=O)c1ccc2cc([125I])ccc2n1.Cl.Cl |
| InChI | InChI=1S/C16H20IN3O.2ClH/c1-3-20(4-2)10-9-18-16(21)15-7-5-12-11-13(17)6-8-14(12)19-15;;/h5-8,11H,3-4,9-10H2,1-2H3,(H,18,21);2*1H/i17-2;; |
| InChIKey | BMWCTQNXYUYZMV-GDGRXHIBSA-N |
| XLogP | 3.75 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.18 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|