C15H19IN4O — CID 24879251
N-[2-(diethylamino)ethyl]-8-(125I)iodo-1,6-naphthyridine-2-carboxamide (PubChem CID 24879251) has the molecular formula C15H19IN4O and a molecular weight of 396.25 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-8-(125I)iodo-1,6-naphthyridine-2-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-8-(125I)iodo-1,6-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 24879251 |
| Molecular Formula | C15H19IN4O |
| Molecular Weight | 396.25 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-8-(125I)iodo-1,6-naphthyridine-2-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc2cncc([125I])c2n1 |
| InChI | InChI=1S/C15H19IN4O/c1-3-20(4-2)8-7-18-15(21)13-6-5-11-9-17-10-12(16)14(11)19-13/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,18,21)/i16-2 |
| InChIKey | BJKQGBVMTWWCOA-RFLHHMENSA-N |
| XLogP | 2.31 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|