C18H24IN3O — CID 59228679
N-[2-(dipropylamino)ethyl]-6-iodoquinoline-2-carboxamide (PubChem CID 59228679) has the molecular formula C18H24IN3O and a molecular weight of 425.31 g/mol. Its IUPAC name is N-[2-(dipropylamino)ethyl]-6-iodoquinoline-2-carboxamide.
| Compound Name | N-[2-(dipropylamino)ethyl]-6-iodoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 59228679 |
| Molecular Formula | C18H24IN3O |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | N-[2-(dipropylamino)ethyl]-6-iodoquinoline-2-carboxamide |
| SMILES | CCCN(CCC)CCNC(=O)c1ccc2cc(I)ccc2n1 |
| InChI | InChI=1S/C18H24IN3O/c1-3-10-22(11-4-2)12-9-20-18(23)17-7-5-14-13-15(19)6-8-16(14)21-17/h5-8,13H,3-4,9-12H2,1-2H3,(H,20,23) |
| InChIKey | AUPDSJGNLVZMCI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|