C17H21IN2O — CID 24797314
N-[2-(diethylamino)ethyl]-6-iodonaphthalene-2-carboxamide (PubChem CID 24797314) has the molecular formula C17H21IN2O and a molecular weight of 396.27 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-6-iodonaphthalene-2-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-6-iodonaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 24797314 |
| Molecular Formula | C17H21IN2O |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-6-iodonaphthalene-2-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc2cc(I)ccc2c1 |
| InChI | InChI=1S/C17H21IN2O/c1-3-20(4-2)10-9-19-17(21)15-6-5-14-12-16(18)8-7-13(14)11-15/h5-8,11-12H,3-4,9-10H2,1-2H3,(H,19,21) |
| InChIKey | LWASXVVCOXTYBN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|