C15H21ClIN3O — CID 24797317
N-[2-(diethylamino)ethyl]-5-iodo-1H-indole-2-carboxamide;hydrochloride (PubChem CID 24797317) has the molecular formula C15H21ClIN3O and a molecular weight of 421.71 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-5-iodo-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(diethylamino)ethyl]-5-iodo-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 24797317 |
| Molecular Formula | C15H21ClIN3O |
| Molecular Weight | 421.71 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-5-iodo-1H-indole-2-carboxamide;hydrochloride |
| SMILES | CCN(CC)CCNC(=O)c1cc2cc(I)ccc2[nH]1.Cl |
| InChI | InChI=1S/C15H20IN3O.ClH/c1-3-19(4-2)8-7-17-15(20)14-10-11-9-12(16)5-6-13(11)18-14;/h5-6,9-10,18H,3-4,7-8H2,1-2H3,(H,17,20);1H |
| InChIKey | ZTRCLSBFDZRMNT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.71 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|