C23H27N5O4 — CID 135122252
2-[[5-[4-[2-(dimethylamino)ethylcarbamoyl]phenyl]-1H-indole-2-carbonyl]amino]ethylcarbamic acid (PubChem CID 135122252) has the molecular formula C23H27N5O4 and a molecular weight of 437.50 g/mol. Its IUPAC name is 2-[[5-[4-[2-(dimethylamino)ethylcarbamoyl]phenyl]-1H-indole-2-carbonyl]amino]ethylcarbamic acid.
| Compound Name | 2-[[5-[4-[2-(dimethylamino)ethylcarbamoyl]phenyl]-1H-indole-2-carbonyl]amino]ethylcarbamic acid |
|---|---|
| PubChem CID | 135122252 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 2-[[5-[4-[2-(dimethylamino)ethylcarbamoyl]phenyl]-1H-indole-2-carbonyl]amino]ethylcarbamic acid |
| SMILES | CN(C)CCNC(=O)c1ccc(-c2ccc3[nH]c(C(=O)NCCNC(=O)O)cc3c2)cc1 |
| InChI | InChI=1S/C23H27N5O4/c1-28(2)12-11-25-21(29)16-5-3-15(4-6-16)17-7-8-19-18(13-17)14-20(27-19)22(30)24-9-10-26-23(31)32/h3-8,13-14,26-27H,9-12H2,1-2H3,(H,24,30)(H,25,29)(H,31,32) |
| InChIKey | UXHSIJWIPYVGOG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|