C31H33N7O4S — CID 135142531
N-[2-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)ethyl]-5-[4-[2-(methylamino)ethylcarbamoyl]phenyl]-1H-indole-2-carboxamide (PubChem CID 135142531) has the molecular formula C31H33N7O4S and a molecular weight of 599.72 g/mol. Its IUPAC name is N-[2-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)ethyl]-5-[4-[2-(methylamino)ethylcarbamoyl]phenyl]-1H-indole-2-carboxamide.
| Compound Name | N-[2-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)ethyl]-5-[4-[2-(methylamino)ethylcarbamoyl]phenyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 135142531 |
| Molecular Formula | C31H33N7O4S |
| Molecular Weight | 599.72 g/mol |
| Exact Mass | 599.23 |
| IUPAC Name | N-[2-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)ethyl]-5-[4-[2-(methylamino)ethylcarbamoyl]phenyl]-1H-indole-2-carboxamide |
| SMILES | CNCCNC(=O)c1ccc(-c2ccc3[nH]c(C(=O)NCCn4c(N)c5cc(OC)c(OC)cc5nc4=S)cc3c2)cc1 |
| InChI | InChI=1S/C31H33N7O4S/c1-33-10-11-34-29(39)19-6-4-18(5-7-19)20-8-9-23-21(14-20)15-25(36-23)30(40)35-12-13-38-28(32)22-16-26(41-2)27(42-3)17-24(22)37-31(38)43/h4-9,14-17,33,36H,10-13,32H2,1-3H3,(H,34,39)(H,35,40) |
| InChIKey | PZZMVMRAXUWNMM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 148.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.72 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|