C26H31N7O4S — CID 135142497
2-N-[2-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)ethyl]-5-N-[2-(ethylamino)ethyl]-1H-indole-2,5-dicarboxamide (PubChem CID 135142497) has the molecular formula C26H31N7O4S and a molecular weight of 537.65 g/mol. Its IUPAC name is 2-N-[2-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)ethyl]-5-N-[2-(ethylamino)ethyl]-1H-indole-2,5-dicarboxamide.
| Compound Name | 2-N-[2-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)ethyl]-5-N-[2-(ethylamino)ethyl]-1H-indole-2,5-dicarboxamide |
|---|---|
| PubChem CID | 135142497 |
| Molecular Formula | C26H31N7O4S |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | 2-N-[2-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)ethyl]-5-N-[2-(ethylamino)ethyl]-1H-indole-2,5-dicarboxamide |
| SMILES | CCNCCNC(=O)c1ccc2[nH]c(C(=O)NCCn3c(N)c4cc(OC)c(OC)cc4nc3=S)cc2c1 |
| InChI | InChI=1S/C26H31N7O4S/c1-4-28-7-8-29-24(34)15-5-6-18-16(11-15)12-20(31-18)25(35)30-9-10-33-23(27)17-13-21(36-2)22(37-3)14-19(17)32-26(33)38/h5-6,11-14,28,31H,4,7-10,27H2,1-3H3,(H,29,34)(H,30,35) |
| InChIKey | FPMNZBGITWISHA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 148.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|