C27H32N6O4S — CID 135140894
1-[2-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)ethyl]-N-(2-morpholin-4-ylethyl)indole-3-carboxamide (PubChem CID 135140894) has the molecular formula C27H32N6O4S and a molecular weight of 536.66 g/mol. Its IUPAC name is 1-[2-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)ethyl]-N-(2-morpholin-4-ylethyl)indole-3-carboxamide.
| Compound Name | 1-[2-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)ethyl]-N-(2-morpholin-4-ylethyl)indole-3-carboxamide |
|---|---|
| PubChem CID | 135140894 |
| Molecular Formula | C27H32N6O4S |
| Molecular Weight | 536.66 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 1-[2-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)ethyl]-N-(2-morpholin-4-ylethyl)indole-3-carboxamide |
| SMILES | COc1cc2nc(=S)n(CCn3cc(C(=O)NCCN4CCOCC4)c4ccccc43)c(N)c2cc1OC |
| InChI | InChI=1S/C27H32N6O4S/c1-35-23-15-19-21(16-24(23)36-2)30-27(38)33(25(19)28)10-9-32-17-20(18-5-3-4-6-22(18)32)26(34)29-7-8-31-11-13-37-14-12-31/h3-6,15-17H,7-14,28H2,1-2H3,(H,29,34) |
| InChIKey | CIQVZDUUKXHMOF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.66 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|