C24H24N4O3 — CID 10180151
4-methoxy-N-(2-morpholin-4-ylethyl)benzo[a]phenazine-11-carboxamide (PubChem CID 10180151) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is 4-methoxy-N-(2-morpholin-4-ylethyl)benzo[a]phenazine-11-carboxamide.
| Compound Name | 4-methoxy-N-(2-morpholin-4-ylethyl)benzo[a]phenazine-11-carboxamide |
|---|---|
| PubChem CID | 10180151 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 4-methoxy-N-(2-morpholin-4-ylethyl)benzo[a]phenazine-11-carboxamide |
| SMILES | COc1cccc2c1ccc1nc3cccc(C(=O)NCCN4CCOCC4)c3nc12 |
| InChI | InChI=1S/C24H24N4O3/c1-30-21-7-3-4-17-16(21)8-9-20-22(17)27-23-18(5-2-6-19(23)26-20)24(29)25-10-11-28-12-14-31-15-13-28/h2-9H,10-15H2,1H3,(H,25,29) |
| InChIKey | WFRIJWQPXWIPTH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|