C23H26N4O4 — CID 102280735
3-[[4-(2-morpholin-4-ylethylcarbamoyl)acridin-9-yl]amino]propanoic acid (PubChem CID 102280735) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 3-[[4-(2-morpholin-4-ylethylcarbamoyl)acridin-9-yl]amino]propanoic acid.
| Compound Name | 3-[[4-(2-morpholin-4-ylethylcarbamoyl)acridin-9-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 102280735 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 3-[[4-(2-morpholin-4-ylethylcarbamoyl)acridin-9-yl]amino]propanoic acid |
| SMILES | O=C(O)CCNc1c2ccccc2nc2c(C(=O)NCCN3CCOCC3)cccc12 |
| InChI | InChI=1S/C23H26N4O4/c28-20(29)8-9-24-21-16-4-1-2-7-19(16)26-22-17(21)5-3-6-18(22)23(30)25-10-11-27-12-14-31-15-13-27/h1-7H,8-15H2,(H,24,26)(H,25,30)(H,28,29) |
| InChIKey | YYVQBMHDFYHHTH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|