C17H20FIN4O — CID 72712878
N-[2-[ethyl-[(E)-4-(18F)fluorobut-2-enyl]amino]ethyl]-6-iodoquinoxaline-2-carboxamide (PubChem CID 72712878) has the molecular formula C17H20FIN4O and a molecular weight of 441.28 g/mol. Its IUPAC name is N-[2-[ethyl-[(E)-4-(18F)fluorobut-2-enyl]amino]ethyl]-6-iodoquinoxaline-2-carboxamide.
| Compound Name | N-[2-[ethyl-[(E)-4-(18F)fluorobut-2-enyl]amino]ethyl]-6-iodoquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 72712878 |
| Molecular Formula | C17H20FIN4O |
| Molecular Weight | 441.28 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | N-[2-[ethyl-[(E)-4-(18F)fluorobut-2-enyl]amino]ethyl]-6-iodoquinoxaline-2-carboxamide |
| SMILES | CCN(C/C=C/C[18F])CCNC(=O)c1cnc2cc(I)ccc2n1 |
| InChI | InChI=1S/C17H20FIN4O/c1-2-23(9-4-3-7-18)10-8-20-17(24)16-12-21-15-11-13(19)5-6-14(15)22-16/h3-6,11-12H,2,7-10H2,1H3,(H,20,24)/b4-3+/i18-1 |
| InChIKey | GHASTSFKWBGDKA-OBKRMRTNSA-N |
| XLogP | 2.81 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|