C26H43N7O4 — CID 122448998
6-[2-[2-[2-(tert-butylamino)ethoxy]ethoxy]ethylcarbamoylamino]-N-[2-(diethylamino)ethyl]quinoxaline-2-carboxamide (PubChem CID 122448998) has the molecular formula C26H43N7O4 and a molecular weight of 517.68 g/mol. Its IUPAC name is 6-[2-[2-[2-(tert-butylamino)ethoxy]ethoxy]ethylcarbamoylamino]-N-[2-(diethylamino)ethyl]quinoxaline-2-carboxamide.
| Compound Name | 6-[2-[2-[2-(tert-butylamino)ethoxy]ethoxy]ethylcarbamoylamino]-N-[2-(diethylamino)ethyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 122448998 |
| Molecular Formula | C26H43N7O4 |
| Molecular Weight | 517.68 g/mol |
| Exact Mass | 517.34 |
| IUPAC Name | 6-[2-[2-[2-(tert-butylamino)ethoxy]ethoxy]ethylcarbamoylamino]-N-[2-(diethylamino)ethyl]quinoxaline-2-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1cnc2cc(NC(=O)NCCOCCOCCNC(C)(C)C)ccc2n1 |
| InChI | InChI=1S/C26H43N7O4/c1-6-33(7-2)13-10-27-24(34)23-19-29-22-18-20(8-9-21(22)32-23)31-25(35)28-11-14-36-16-17-37-15-12-30-26(3,4)5/h8-9,18-19,30H,6-7,10-17H2,1-5H3,(H,27,34)(H2,28,31,35) |
| InChIKey | ROPUEYFBMLGGLL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 129.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.68 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|