C20H34N4O3 — CID 75456654
N-tert-butyl-3-[2-[2-(diethylamino)ethoxy]ethylcarbamoylamino]benzamide (PubChem CID 75456654) has the molecular formula C20H34N4O3 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-tert-butyl-3-[2-[2-(diethylamino)ethoxy]ethylcarbamoylamino]benzamide.
| Compound Name | N-tert-butyl-3-[2-[2-(diethylamino)ethoxy]ethylcarbamoylamino]benzamide |
|---|---|
| PubChem CID | 75456654 |
| Molecular Formula | C20H34N4O3 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | N-tert-butyl-3-[2-[2-(diethylamino)ethoxy]ethylcarbamoylamino]benzamide |
| SMILES | CCN(CC)CCOCCNC(=O)Nc1cccc(C(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C20H34N4O3/c1-6-24(7-2)12-14-27-13-11-21-19(26)22-17-10-8-9-16(15-17)18(25)23-20(3,4)5/h8-10,15H,6-7,11-14H2,1-5H3,(H,23,25)(H2,21,22,26) |
| InChIKey | ZVOUVGVIWKVYKO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|