C21H30FIN4O4 — CID 72712880
N-[2-[ethyl-[2-[2-[2-(2-(18F)fluoroethoxy)ethoxy]ethoxy]ethyl]amino]ethyl]-6-iodoquinoxaline-2-carboxamide (PubChem CID 72712880) has the molecular formula C21H30FIN4O4 and a molecular weight of 547.40 g/mol. Its IUPAC name is N-[2-[ethyl-[2-[2-[2-(2-(18F)fluoroethoxy)ethoxy]ethoxy]ethyl]amino]ethyl]-6-iodoquinoxaline-2-carboxamide.
| Compound Name | N-[2-[ethyl-[2-[2-[2-(2-(18F)fluoroethoxy)ethoxy]ethoxy]ethyl]amino]ethyl]-6-iodoquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 72712880 |
| Molecular Formula | C21H30FIN4O4 |
| Molecular Weight | 547.40 g/mol |
| Exact Mass | 547.13 |
| IUPAC Name | N-[2-[ethyl-[2-[2-[2-(2-(18F)fluoroethoxy)ethoxy]ethoxy]ethyl]amino]ethyl]-6-iodoquinoxaline-2-carboxamide |
| SMILES | CCN(CCNC(=O)c1cnc2cc(I)ccc2n1)CCOCCOCCOCC[18F] |
| InChI | InChI=1S/C21H30FIN4O4/c1-2-27(8-10-30-12-14-31-13-11-29-9-5-22)7-6-24-21(28)20-16-25-19-15-17(23)3-4-18(19)26-20/h3-4,15-16H,2,5-14H2,1H3,(H,24,28)/i22-1 |
| InChIKey | UTCCSNWUOVPLPB-KVTPGWOSSA-N |
| XLogP | 2.31 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|