C20H24Cl2FIN6O — CID 52950976
N-[2-[ethyl-[2-[(6-fluoro-2-pyridinyl)amino]ethyl]amino]ethyl]-6-(125I)iodoquinoxaline-2-carboxamide;dihydrochloride (PubChem CID 52950976) has the molecular formula C20H24Cl2FIN6O and a molecular weight of 579.26 g/mol. Its IUPAC name is N-[2-[ethyl-[2-[(6-fluoro-2-pyridinyl)amino]ethyl]amino]ethyl]-6-(125I)iodoquinoxaline-2-carboxamide;dihydrochloride.
| Compound Name | N-[2-[ethyl-[2-[(6-fluoro-2-pyridinyl)amino]ethyl]amino]ethyl]-6-(125I)iodoquinoxaline-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 52950976 |
| Molecular Formula | C20H24Cl2FIN6O |
| Molecular Weight | 579.26 g/mol |
| Exact Mass | 578.04 |
| IUPAC Name | N-[2-[ethyl-[2-[(6-fluoro-2-pyridinyl)amino]ethyl]amino]ethyl]-6-(125I)iodoquinoxaline-2-carboxamide;dihydrochloride |
| SMILES | CCN(CCNC(=O)c1cnc2cc([125I])ccc2n1)CCNc1cccc(F)n1.Cl.Cl |
| InChI | InChI=1S/C20H22FIN6O.2ClH/c1-2-28(10-8-23-19-5-3-4-18(21)27-19)11-9-24-20(29)17-13-25-16-12-14(22)6-7-15(16)26-17;;/h3-7,12-13H,2,8-11H2,1H3,(H,23,27)(H,24,29);2*1H/i22-2;; |
| InChIKey | DDXPIUYWRKHBMR-QRCGIRNOSA-N |
| XLogP | 3.78 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.26 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|